About 2-ethoxy-4-hexyl-1,3-dioxole
2-ethoxy-4-hexyl-1,3-dioxole (PubChem CID 140996391) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-ethoxy-4-hexyl-1,3-dioxole.
Molecular Properties
| Compound Name | 2-ethoxy-4-hexyl-1,3-dioxole |
| PubChem CID | 140996391 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-ethoxy-4-hexyl-1,3-dioxole |
| SMILES | CCCCCCC1=COC(OCC)O1 |
| InChI | InChI=1S/C11H20O3/c1-3-5-6-7-8-10-9-13-11(14-10)12-4-2/h9,11H,3-8H2,1-2H3 |
| InChIKey | OMVQEOJFKZQOHU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-4-hexyl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-hexyl-1,3-dioxole?
The IUPAC name of 2-ethoxy-4-hexyl-1,3-dioxole (CID 140996391) is 2-ethoxy-4-hexyl-1,3-dioxole.
What is the SMILES notation for 2-ethoxy-4-hexyl-1,3-dioxole?
The canonical SMILES for 2-ethoxy-4-hexyl-1,3-dioxole is CCCCCCC1=COC(OCC)O1.
What is the InChIKey of 2-ethoxy-4-hexyl-1,3-dioxole?
The InChIKey is OMVQEOJFKZQOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-5-6-7-8-10-9-13-11(14-10)12-4-2/h9,11H,3-8H2,1-2H3.
What are the key properties of 2-ethoxy-4-hexyl-1,3-dioxole?
2-ethoxy-4-hexyl-1,3-dioxole has a molecular weight of 200.28 g/mol, XLogP of 3.17, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-hexyl-1,3-dioxole is sourced from PubChem (CID 140996391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).