About 1-methyl-5,7-dihydropteridin-6-one
1-methyl-5,7-dihydropteridin-6-one (PubChem CID 140996867) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 1-methyl-5,7-dihydropteridin-6-one.
Molecular Properties
| Compound Name | 1-methyl-5,7-dihydropteridin-6-one |
| PubChem CID | 140996867 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1-methyl-5,7-dihydropteridin-6-one |
| SMILES | CN1C=NC=C2NC(=O)CN=C21 |
| InChI | InChI=1S/C7H8N4O/c1-11-4-8-2-5-7(11)9-3-6(12)10-5/h2,4H,3H2,1H3,(H,10,12) |
| InChIKey | XMRGQFIJCNZQPN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5,7-dihydropteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,7-dihydropteridin-6-one?
The IUPAC name of 1-methyl-5,7-dihydropteridin-6-one (CID 140996867) is 1-methyl-5,7-dihydropteridin-6-one.
What is the SMILES notation for 1-methyl-5,7-dihydropteridin-6-one?
The canonical SMILES for 1-methyl-5,7-dihydropteridin-6-one is CN1C=NC=C2NC(=O)CN=C21.
What is the InChIKey of 1-methyl-5,7-dihydropteridin-6-one?
The InChIKey is XMRGQFIJCNZQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-11-4-8-2-5-7(11)9-3-6(12)10-5/h2,4H,3H2,1H3,(H,10,12).
What are the key properties of 1-methyl-5,7-dihydropteridin-6-one?
1-methyl-5,7-dihydropteridin-6-one has a molecular weight of 164.17 g/mol, XLogP of -0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,7-dihydropteridin-6-one is sourced from PubChem (CID 140996867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).