C29H43ClO6 — CID 14099721
2,6-ditert-butyl-4-[(E)-3-(2,6-ditert-butylpyran-4-ylidene)prop-1-enyl]pyrylium perchlorate (PubChem CID 14099721) has the molecular formula C29H43ClO6 and a molecular weight of 523.11 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(E)-3-(2,6-ditert-butylpyran-4-ylidene)prop-1-enyl]pyrylium perchlorate.
| Compound Name | 2,6-ditert-butyl-4-[(E)-3-(2,6-ditert-butylpyran-4-ylidene)prop-1-enyl]pyrylium perchlorate |
|---|---|
| PubChem CID | 14099721 |
| Molecular Formula | C29H43ClO6 |
| Molecular Weight | 523.11 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(E)-3-(2,6-ditert-butylpyran-4-ylidene)prop-1-enyl]pyrylium perchlorate |
| SMILES | CC(C)(C)C1=CC(=C/C=C/c2cc(C(C)(C)C)[o+]c(C(C)(C)C)c2)C=C(C(C)(C)C)O1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H43O2.ClHO4/c1-26(2,3)22-16-20(17-23(30-22)27(4,5)6)14-13-15-21-18-24(28(7,8)9)31-25(19-21)29(10,11)12;2-1(3,4)5/h13-19H,1-12H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KMANXGPAKDBFMC-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.11 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|