C13H16O7 — CID 140997217
benzyl (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 140997217) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is benzyl (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | benzyl (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 140997217 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | benzyl (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | O=C[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16O7/c14-6-9(15)10(16)11(17)12(18)13(19)20-7-8-4-2-1-3-5-8/h1-6,9-12,15-18H,7H2/t9-,10+,11-,12+/m1/s1 |
| InChIKey | WFZOFLXHKAFEDZ-KXNHARMFSA-N |
| XLogP | -1.63 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|