C22H35NSi — CID 140997986
N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;(2E,4E)-hexa-2,4-diene (PubChem CID 140997986) has the molecular formula C22H35NSi and a molecular weight of 341.62 g/mol. Its IUPAC name is N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;(2E,4E)-hexa-2,4-diene.
| Compound Name | N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;(2E,4E)-hexa-2,4-diene |
|---|---|
| PubChem CID | 140997986 |
| Molecular Formula | C22H35NSi |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;(2E,4E)-hexa-2,4-diene |
| SMILES | C/C=C/C=C/C.CC1=Cc2ccccc2C1[Si](C)(C)NC(C)(C)C |
| InChI | InChI=1S/C16H25NSi.C6H10/c1-12-11-13-9-7-8-10-14(13)15(12)18(5,6)17-16(2,3)4;1-3-5-6-4-2/h7-11,15,17H,1-6H3;3-6H,1-2H3/b;5-3+,6-4+ |
| InChIKey | FSHQNBFQKPLFHN-YYZUWOOQSA-N |
| XLogP | 6.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|