C14H18BrClN2 — CID 140998240
(2R)-6-bromo-N,N-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine;hydrochloride (PubChem CID 140998240) has the molecular formula C14H18BrClN2 and a molecular weight of 329.67 g/mol. Its IUPAC name is (2R)-6-bromo-N,N-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine;hydrochloride.
| Compound Name | (2R)-6-bromo-N,N-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 140998240 |
| Molecular Formula | C14H18BrClN2 |
| Molecular Weight | 329.67 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (2R)-6-bromo-N,N-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine;hydrochloride |
| SMILES | CN(C)[C@@H]1CCc2c([nH]c3ccc(Br)cc23)C1.Cl |
| InChI | InChI=1S/C14H17BrN2.ClH/c1-17(2)10-4-5-11-12-7-9(15)3-6-13(12)16-14(11)8-10;/h3,6-7,10,16H,4-5,8H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | GDRXBWYMRCTVKL-HNCPQSOCSA-N |
| XLogP | 3.77 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|