About N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine
N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine (PubChem CID 140998523) has the molecular formula C14H11ClN2O3
and a molecular weight of 290.71 g/mol. Its IUPAC name is N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine.
Molecular Properties
| Compound Name | N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine |
| PubChem CID | 140998523 |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine |
| SMILES | C#CCOc1cc(CON=C=N)cc(Cl)c1OCC#C |
| InChI | InChI=1S/C14H11ClN2O3/c1-3-5-18-13-8-11(9-20-17-10-16)7-12(15)14(13)19-6-4-2/h1-2,7-8,16H,5-6,9H2 |
| InChIKey | NGDLUDHXNYDURL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine?
The IUPAC name of N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine (CID 140998523) is N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine.
What is the SMILES notation for N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine?
The canonical SMILES for N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine is C#CCOc1cc(CON=C=N)cc(Cl)c1OCC#C.
What is the InChIKey of N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine?
The InChIKey is NGDLUDHXNYDURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O3/c1-3-5-18-13-8-11(9-20-17-10-16)7-12(15)14(13)19-6-4-2/h1-2,7-8,16H,5-6,9H2.
What are the key properties of N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine?
N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine has a molecular weight of 290.71 g/mol, XLogP of 2.55, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[3-chloro-4,5-bis(prop-2-ynoxy)phenyl]methoxy]methanediimine is sourced from PubChem (CID 140998523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).