C8H8NaO8S4Sb — CID 140999058
sodium 3-(disulfanyl)-4-[[5-(disulfanyl)-4,7-dioxo-1,3,2-dioxastibepan-2-yl]oxy]-4-oxobutanoate (PubChem CID 140999058) has the molecular formula C8H8NaO8S4Sb and a molecular weight of 505.16 g/mol. Its IUPAC name is sodium 3-(disulfanyl)-4-[[5-(disulfanyl)-4,7-dioxo-1,3,2-dioxastibepan-2-yl]oxy]-4-oxobutanoate.
| Compound Name | sodium 3-(disulfanyl)-4-[[5-(disulfanyl)-4,7-dioxo-1,3,2-dioxastibepan-2-yl]oxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 140999058 |
| Molecular Formula | C8H8NaO8S4Sb |
| Molecular Weight | 505.16 g/mol |
| Exact Mass | 503.80 |
| IUPAC Name | sodium 3-(disulfanyl)-4-[[5-(disulfanyl)-4,7-dioxo-1,3,2-dioxastibepan-2-yl]oxy]-4-oxobutanoate |
| SMILES | O=C([O-])CC(SS)C(=O)O[Sb]1OC(=O)CC(SS)C(=O)O1.[Na+] |
| InChI | InChI=1S/2C4H6O4S2.Na.Sb/c2*5-3(6)1-2(10-9)4(7)8;;/h2*2,9H,1H2,(H,5,6)(H,7,8);;/q;;+1;+3/p-4 |
| InChIKey | HWYHBKNJXAGFMV-UHFFFAOYSA-J |
| XLogP | -3.96 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.16 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|