C24H42O7 — CID 140999708
[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 140999708) has the molecular formula C24H42O7 and a molecular weight of 442.59 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 140999708 |
| Molecular Formula | C24H42O7 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H42O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)31-24-23(29)22(28)21(27)19(18-25)30-24/h6-7,9-10,19,21-25,27-29H,2-5,8,11-18H2,1H3/b7-6-,10-9-/t19-,21+,22+,23-,24?/m1/s1 |
| InChIKey | WBDBASNWGFIBSM-LSXBJDKESA-N |
| XLogP | 3.14 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|