C11H9F5N2O3 — CID 141000624
(2S)-2-[[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]propanamide (PubChem CID 141000624) has the molecular formula C11H9F5N2O3 and a molecular weight of 312.19 g/mol. Its IUPAC name is (2S)-2-[[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]propanamide.
| Compound Name | (2S)-2-[[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 141000624 |
| Molecular Formula | C11H9F5N2O3 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (2S)-2-[[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]propanamide |
| SMILES | C[C@H](NC(=O)COc1c(F)c(F)c(F)c(F)c1F)C(N)=O |
| InChI | InChI=1S/C11H9F5N2O3/c1-3(11(17)20)18-4(19)2-21-10-8(15)6(13)5(12)7(14)9(10)16/h3H,2H2,1H3,(H2,17,20)(H,18,19)/t3-/m0/s1 |
| InChIKey | WDBDQUSHOSHIPN-VKHMYHEASA-N |
| XLogP | 0.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|