C10H15NO2 — CID 141000664
methyl 1,2,3,4,5,7a-hexahydroisoindole-3a-carboxylate (PubChem CID 141000664) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is methyl 1,2,3,4,5,7a-hexahydroisoindole-3a-carboxylate.
| Compound Name | methyl 1,2,3,4,5,7a-hexahydroisoindole-3a-carboxylate |
|---|---|
| PubChem CID | 141000664 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | methyl 1,2,3,4,5,7a-hexahydroisoindole-3a-carboxylate |
| SMILES | COC(=O)C12CCC=CC1CNC2 |
| InChI | InChI=1S/C10H15NO2/c1-13-9(12)10-5-3-2-4-8(10)6-11-7-10/h2,4,8,11H,3,5-7H2,1H3 |
| InChIKey | HUFPLLFZUKNEND-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|