About methyl indole-3a-carboxylate;hydrochloride
methyl indole-3a-carboxylate;hydrochloride (PubChem CID 141000683) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is methyl indole-3a-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl indole-3a-carboxylate;hydrochloride |
| PubChem CID | 141000683 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | methyl indole-3a-carboxylate;hydrochloride |
| SMILES | COC(=O)C12C=CC=CC1=NC=C2.Cl |
| InChI | InChI=1S/C10H9NO2.ClH/c1-13-9(12)10-5-3-2-4-8(10)11-7-6-10;/h2-7H,1H3;1H |
| InChIKey | QUHGRXBJKDGDBH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl indole-3a-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl indole-3a-carboxylate;hydrochloride?
The IUPAC name of methyl indole-3a-carboxylate;hydrochloride (CID 141000683) is methyl indole-3a-carboxylate;hydrochloride.
What is the SMILES notation for methyl indole-3a-carboxylate;hydrochloride?
The canonical SMILES for methyl indole-3a-carboxylate;hydrochloride is COC(=O)C12C=CC=CC1=NC=C2.Cl.
What is the InChIKey of methyl indole-3a-carboxylate;hydrochloride?
The InChIKey is QUHGRXBJKDGDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.ClH/c1-13-9(12)10-5-3-2-4-8(10)11-7-6-10;/h2-7H,1H3;1H.
What are the key properties of methyl indole-3a-carboxylate;hydrochloride?
methyl indole-3a-carboxylate;hydrochloride has a molecular weight of 211.65 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl indole-3a-carboxylate;hydrochloride is sourced from PubChem (CID 141000683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).