C8H9NO — CID 141000711
2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrol-4-ylidenemethanone (PubChem CID 141000711) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrol-4-ylidenemethanone.
| Compound Name | 2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrol-4-ylidenemethanone |
|---|---|
| PubChem CID | 141000711 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2,3,3a,6a-tetrahydro-1H-cyclopenta[c]pyrrol-4-ylidenemethanone |
| SMILES | O=C=C1C=CC2CNCC12 |
| InChI | InChI=1S/C8H9NO/c10-5-7-2-1-6-3-9-4-8(6)7/h1-2,6,8-9H,3-4H2 |
| InChIKey | WMYYGMGKNUTOOZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|