About 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin
5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin (PubChem CID 141001315) has the molecular formula C20H34N2SSn
and a molecular weight of 453.28 g/mol. Its IUPAC name is 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin |
| PubChem CID | 141001315 |
| Molecular Formula | C20H34N2SSn |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1c(CC)sc2cncn12 |
| InChI | InChI=1S/C13H27.C7H7N2S.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-6-4-9-5-8-3-7(9)10-6;/h4-12H2,1-3H3;3,5H,2H2,1H3; |
| InChIKey | PWTWTNRWZNPBCD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin?
The IUPAC name of 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin (CID 141001315) is 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin.
What is the SMILES notation for 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin?
The canonical SMILES for 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin is CCCCC(CCCC)(CCCC)[Sn]c1c(CC)sc2cncn12.
What is the InChIKey of 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin?
The InChIKey is PWTWTNRWZNPBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C7H7N2S.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-6-4-9-5-8-3-7(9)10-6;/h4-12H2,1-3H3;3,5H,2H2,1H3;.
What are the key properties of 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin?
5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin has a molecular weight of 453.28 g/mol, XLogP of 6.02, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-(2-ethylimidazo[5,1-b][1,3]thiazol-3-yl)tin is sourced from PubChem (CID 141001315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).