C14H8N4O2S — CID 141001732
3-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 141001732) has the molecular formula C14H8N4O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 3-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 3-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 141001732 |
| Molecular Formula | C14H8N4O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)c2c1sc1nccnc12 |
| InChI | InChI=1S/C14H8N4O2S/c19-12-11-10(9-13(21-11)16-7-6-15-9)18(14(20)17-12)8-4-2-1-3-5-8/h1-7H,(H,17,19,20) |
| InChIKey | NGJSARYCFZTLBI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |