About 4-ethynyl-7-propyltrideca-5,8-diyne
4-ethynyl-7-propyltrideca-5,8-diyne (PubChem CID 141002022) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is 4-ethynyl-7-propyltrideca-5,8-diyne.
Molecular Properties
| Compound Name | 4-ethynyl-7-propyltrideca-5,8-diyne |
| PubChem CID | 141002022 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-ethynyl-7-propyltrideca-5,8-diyne |
| SMILES | C#CC(C#CC(C#CCCCC)CCC)CCC |
| InChI | InChI=1S/C18H26/c1-5-9-10-11-14-18(13-7-3)16-15-17(8-4)12-6-2/h4,17-18H,5-7,9-10,12-13H2,1-3H3 |
| InChIKey | AVSDYYCFRSXUTK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-7-propyltrideca-5,8-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-7-propyltrideca-5,8-diyne?
The IUPAC name of 4-ethynyl-7-propyltrideca-5,8-diyne (CID 141002022) is 4-ethynyl-7-propyltrideca-5,8-diyne.
What is the SMILES notation for 4-ethynyl-7-propyltrideca-5,8-diyne?
The canonical SMILES for 4-ethynyl-7-propyltrideca-5,8-diyne is C#CC(C#CC(C#CCCCC)CCC)CCC.
What is the InChIKey of 4-ethynyl-7-propyltrideca-5,8-diyne?
The InChIKey is AVSDYYCFRSXUTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26/c1-5-9-10-11-14-18(13-7-3)16-15-17(8-4)12-6-2/h4,17-18H,5-7,9-10,12-13H2,1-3H3.
What are the key properties of 4-ethynyl-7-propyltrideca-5,8-diyne?
4-ethynyl-7-propyltrideca-5,8-diyne has a molecular weight of 242.41 g/mol, XLogP of 4.65, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-7-propyltrideca-5,8-diyne is sourced from PubChem (CID 141002022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).