C11H11F6NO — CID 141002088
N-ethyl-N-(1,1,2,3,3,3-hexafluoropropoxy)aniline (PubChem CID 141002088) has the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. Its IUPAC name is N-ethyl-N-(1,1,2,3,3,3-hexafluoropropoxy)aniline.
| Compound Name | N-ethyl-N-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
|---|---|
| PubChem CID | 141002088 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-ethyl-N-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| SMILES | CCN(OC(F)(F)C(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H11F6NO/c1-2-18(8-6-4-3-5-7-8)19-11(16,17)9(12)10(13,14)15/h3-7,9H,2H2,1H3 |
| InChIKey | CUWCJWUENHAWGO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|