C17H22N6O2 — CID 14100217
7-[(4-aminophenyl)methyl]-5-butyl-3-(methylamino)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione (PubChem CID 14100217) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 7-[(4-aminophenyl)methyl]-5-butyl-3-(methylamino)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione.
| Compound Name | 7-[(4-aminophenyl)methyl]-5-butyl-3-(methylamino)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 14100217 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 7-[(4-aminophenyl)methyl]-5-butyl-3-(methylamino)-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| SMILES | CCCCn1c(=O)c2c(NC)[nH]nc2n(Cc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C17H22N6O2/c1-3-4-9-22-16(24)13-14(19-2)20-21-15(13)23(17(22)25)10-11-5-7-12(18)8-6-11/h5-8H,3-4,9-10,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | CLVPEDPUVRBUJS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|