C16H22N2 — CID 141002977
3-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methylpropan-1-amine (PubChem CID 141002977) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methylpropan-1-amine.
| Compound Name | 3-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 141002977 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methylpropan-1-amine |
| SMILES | Cc1ccc(C)n1-c1ccc(CC(C)CN)cc1 |
| InChI | InChI=1S/C16H22N2/c1-12(11-17)10-15-6-8-16(9-7-15)18-13(2)4-5-14(18)3/h4-9,12H,10-11,17H2,1-3H3 |
| InChIKey | LMOZZLWJAMWFRH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|