About 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole
7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole (PubChem CID 141003469) has the molecular formula C21H23FN2
and a molecular weight of 322.43 g/mol. Its IUPAC name is 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole.
Molecular Properties
| Compound Name | 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole |
| PubChem CID | 141003469 |
| Molecular Formula | C21H23FN2 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole |
| SMILES | Fc1ccc(CCN2CCC(=C3CCC=C4C=CN=C43)CC2)cc1 |
| InChI | InChI=1S/C21H23FN2/c22-19-6-4-16(5-7-19)9-13-24-14-10-17(11-15-24)20-3-1-2-18-8-12-23-21(18)20/h2,4-8,12H,1,3,9-11,13-15H2 |
| InChIKey | ONRIYKZBAOPBSQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole?
The IUPAC name of 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole (CID 141003469) is 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole.
What is the SMILES notation for 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole?
The canonical SMILES for 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole is Fc1ccc(CCN2CCC(=C3CCC=C4C=CN=C43)CC2)cc1.
What is the InChIKey of 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole?
The InChIKey is ONRIYKZBAOPBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2/c22-19-6-4-16(5-7-19)9-13-24-14-10-17(11-15-24)20-3-1-2-18-8-12-23-21(18)20/h2,4-8,12H,1,3,9-11,13-15H2.
What are the key properties of 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole?
7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole has a molecular weight of 322.43 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-ylidene]-5,6-dihydroindole is sourced from PubChem (CID 141003469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).