C32H56S2 — CID 141004044
7-but-1-enyl-6-ethenyl-5-(3-ethylsulfanylpropyl)-7-prop-1-enyl-6-(3-propylsulfanylpropyl)dodeca-4,8-diene (PubChem CID 141004044) has the molecular formula C32H56S2 and a molecular weight of 504.93 g/mol. Its IUPAC name is 7-but-1-enyl-6-ethenyl-5-(3-ethylsulfanylpropyl)-7-prop-1-enyl-6-(3-propylsulfanylpropyl)dodeca-4,8-diene.
| Compound Name | 7-but-1-enyl-6-ethenyl-5-(3-ethylsulfanylpropyl)-7-prop-1-enyl-6-(3-propylsulfanylpropyl)dodeca-4,8-diene |
|---|---|
| PubChem CID | 141004044 |
| Molecular Formula | C32H56S2 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | 7-but-1-enyl-6-ethenyl-5-(3-ethylsulfanylpropyl)-7-prop-1-enyl-6-(3-propylsulfanylpropyl)dodeca-4,8-diene |
| SMILES | C=CC(CCCSCCC)(C(=CCCC)CCCSCC)C(C=CC)(C=CCC)C=CCCC |
| InChI | InChI=1S/C32H56S2/c1-8-15-18-25-31(23-11-4,24-17-10-3)32(13-6,26-20-29-34-27-12-5)30(21-16-9-2)22-19-28-33-14-7/h11,13,17-18,21,23-25H,6,8-10,12,14-16,19-20,22,26-29H2,1-5,7H3 |
| InChIKey | QPWDAFQTBRYLEZ-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|