About 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole
3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole (PubChem CID 141004307) has the molecular formula C15H18N2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole |
| PubChem CID | 141004307 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole |
| SMILES | CC1C2CCN1CC(c1nsc3ccccc13)C2 |
| InChI | InChI=1S/C15H18N2S/c1-10-11-6-7-17(10)9-12(8-11)15-13-4-2-3-5-14(13)18-16-15/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | SWVCEFQUOXTHBG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole?
The IUPAC name of 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole (CID 141004307) is 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole.
What is the SMILES notation for 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole?
The canonical SMILES for 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole is CC1C2CCN1CC(c1nsc3ccccc13)C2.
What is the InChIKey of 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole?
The InChIKey is SWVCEFQUOXTHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2S/c1-10-11-6-7-17(10)9-12(8-11)15-13-4-2-3-5-14(13)18-16-15/h2-5,10-12H,6-9H2,1H3.
What are the key properties of 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole?
3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole has a molecular weight of 258.39 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-methyl-1-azabicyclo[3.2.1]octan-3-yl)-1,2-benzothiazole is sourced from PubChem (CID 141004307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).