C6H3N3Se — CID 141004544
7-selena-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene (PubChem CID 141004544) has the molecular formula C6H3N3Se and a molecular weight of 196.07 g/mol. Its IUPAC name is 7-selena-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene.
| Compound Name | 7-selena-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 141004544 |
| Molecular Formula | C6H3N3Se |
| Molecular Weight | 196.07 g/mol |
| Exact Mass | 196.95 |
| IUPAC Name | 7-selena-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene |
| SMILES | c1cc2c3nnn(c3c1)[Se]2 |
| InChI | InChI=1S/C6H3N3Se/c1-2-4-6-5(3-1)10-9(4)8-7-6/h1-3H |
| InChIKey | DTMOGOPSIODVBO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.07 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|