About 4-cyclobutyl-4,5-dihydro-1,2-thiazole
4-cyclobutyl-4,5-dihydro-1,2-thiazole (PubChem CID 141005106) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 4-cyclobutyl-4,5-dihydro-1,2-thiazole.
Molecular Properties
| Compound Name | 4-cyclobutyl-4,5-dihydro-1,2-thiazole |
| PubChem CID | 141005106 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 4-cyclobutyl-4,5-dihydro-1,2-thiazole |
| SMILES | C1=NSCC1C1CCC1 |
| InChI | InChI=1S/C7H11NS/c1-2-6(3-1)7-4-8-9-5-7/h4,6-7H,1-3,5H2 |
| InChIKey | CWPLYLDRVBUCRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclobutyl-4,5-dihydro-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyl-4,5-dihydro-1,2-thiazole?
The IUPAC name of 4-cyclobutyl-4,5-dihydro-1,2-thiazole (CID 141005106) is 4-cyclobutyl-4,5-dihydro-1,2-thiazole.
What is the SMILES notation for 4-cyclobutyl-4,5-dihydro-1,2-thiazole?
The canonical SMILES for 4-cyclobutyl-4,5-dihydro-1,2-thiazole is C1=NSCC1C1CCC1.
What is the InChIKey of 4-cyclobutyl-4,5-dihydro-1,2-thiazole?
The InChIKey is CWPLYLDRVBUCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-2-6(3-1)7-4-8-9-5-7/h4,6-7H,1-3,5H2.
What are the key properties of 4-cyclobutyl-4,5-dihydro-1,2-thiazole?
4-cyclobutyl-4,5-dihydro-1,2-thiazole has a molecular weight of 141.24 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyl-4,5-dihydro-1,2-thiazole is sourced from PubChem (CID 141005106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).