C17H16N2O3 — CID 141005513
2-[1-oxo-6-(pyrimidin-5-ylmethoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetaldehyde (PubChem CID 141005513) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[1-oxo-6-(pyrimidin-5-ylmethoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetaldehyde.
| Compound Name | 2-[1-oxo-6-(pyrimidin-5-ylmethoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 141005513 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[1-oxo-6-(pyrimidin-5-ylmethoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetaldehyde |
| SMILES | O=CCC1CCc2cc(OCc3cncnc3)ccc2C1=O |
| InChI | InChI=1S/C17H16N2O3/c20-6-5-13-1-2-14-7-15(3-4-16(14)17(13)21)22-10-12-8-18-11-19-9-12/h3-4,6-9,11,13H,1-2,5,10H2 |
| InChIKey | OFOQWWJFUKJYBD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|