About 2H-pyridine-1-carboxamide;hydrochloride
2H-pyridine-1-carboxamide;hydrochloride (PubChem CID 141005861) has the molecular formula C6H9ClN2O
and a molecular weight of 160.60 g/mol. Its IUPAC name is 2H-pyridine-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 2H-pyridine-1-carboxamide;hydrochloride |
| PubChem CID | 141005861 |
| Molecular Formula | C6H9ClN2O |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 2H-pyridine-1-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)N1C=CC=CC1 |
| InChI | InChI=1S/C6H8N2O.ClH/c7-6(9)8-4-2-1-3-5-8;/h1-4H,5H2,(H2,7,9);1H |
| InChIKey | CQQONTJBCVMXDP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-pyridine-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyridine-1-carboxamide;hydrochloride?
The IUPAC name of 2H-pyridine-1-carboxamide;hydrochloride (CID 141005861) is 2H-pyridine-1-carboxamide;hydrochloride.
What is the SMILES notation for 2H-pyridine-1-carboxamide;hydrochloride?
The canonical SMILES for 2H-pyridine-1-carboxamide;hydrochloride is Cl.NC(=O)N1C=CC=CC1.
What is the InChIKey of 2H-pyridine-1-carboxamide;hydrochloride?
The InChIKey is CQQONTJBCVMXDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.ClH/c7-6(9)8-4-2-1-3-5-8;/h1-4H,5H2,(H2,7,9);1H.
What are the key properties of 2H-pyridine-1-carboxamide;hydrochloride?
2H-pyridine-1-carboxamide;hydrochloride has a molecular weight of 160.60 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyridine-1-carboxamide;hydrochloride is sourced from PubChem (CID 141005861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).