C22H14Cl2F3N — CID 141006265
1-[(3,4-dichlorophenyl)methyl]-4-[4-(trifluoromethyl)phenyl]indole (PubChem CID 141006265) has the molecular formula C22H14Cl2F3N and a molecular weight of 420.26 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-[4-(trifluoromethyl)phenyl]indole.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-[4-(trifluoromethyl)phenyl]indole |
|---|---|
| PubChem CID | 141006265 |
| Molecular Formula | C22H14Cl2F3N |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-[4-(trifluoromethyl)phenyl]indole |
| SMILES | FC(F)(F)c1ccc(-c2cccc3c2ccn3Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H14Cl2F3N/c23-19-9-4-14(12-20(19)24)13-28-11-10-18-17(2-1-3-21(18)28)15-5-7-16(8-6-15)22(25,26)27/h1-12H,13H2 |
| InChIKey | BMHCWFXJSQHMRK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |