About 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid
5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 141006595) has the molecular formula C9H11FO5
and a molecular weight of 218.18 g/mol. Its IUPAC name is 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 141006595 |
| Molecular Formula | C9H11FO5 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | COC1=C(O)C(F)(OC)CC(C(=O)O)=C1 |
| InChI | InChI=1S/C9H11FO5/c1-14-6-3-5(8(12)13)4-9(10,15-2)7(6)11/h3,11H,4H2,1-2H3,(H,12,13) |
| InChIKey | MCXCYEAJFBPHRB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid (CID 141006595) is 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid is COC1=C(O)C(F)(OC)CC(C(=O)O)=C1.
What is the InChIKey of 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is MCXCYEAJFBPHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO5/c1-14-6-3-5(8(12)13)4-9(10,15-2)7(6)11/h3,11H,4H2,1-2H3,(H,12,13).
What are the key properties of 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid?
5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 218.18 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-hydroxy-3,5-dimethoxycyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 141006595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).