C28H44N10 — CID 141007122
3-(diaminomethylidene)-1-[1-[N-[N-(diaminomethylidene)carbamimidoyl]-4-(2-methylbutan-2-yl)anilino]ethyl]-1-[4-(2-methylbutan-2-yl)phenyl]guanidine (PubChem CID 141007122) has the molecular formula C28H44N10 and a molecular weight of 520.73 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-[1-[N-[N-(diaminomethylidene)carbamimidoyl]-4-(2-methylbutan-2-yl)anilino]ethyl]-1-[4-(2-methylbutan-2-yl)phenyl]guanidine.
| Compound Name | 3-(diaminomethylidene)-1-[1-[N-[N-(diaminomethylidene)carbamimidoyl]-4-(2-methylbutan-2-yl)anilino]ethyl]-1-[4-(2-methylbutan-2-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 141007122 |
| Molecular Formula | C28H44N10 |
| Molecular Weight | 520.73 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | 3-(diaminomethylidene)-1-[1-[N-[N-(diaminomethylidene)carbamimidoyl]-4-(2-methylbutan-2-yl)anilino]ethyl]-1-[4-(2-methylbutan-2-yl)phenyl]guanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(c1ccc(C(C)(C)CC)cc1)C(C)N(/C(N=C(N)N)=N\[H])c1ccc(C(C)(C)CC)cc1 |
| InChI | InChI=1S/C28H44N10/c1-8-27(4,5)19-10-14-21(15-11-19)37(25(33)35-23(29)30)18(3)38(26(34)36-24(31)32)22-16-12-20(13-17-22)28(6,7)9-2/h10-18H,8-9H2,1-7H3,(H5,29,30,33,35)(H5,31,32,34,36) |
| InChIKey | RERINBRNDLGSTO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|