About 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate
2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate (PubChem CID 141007289) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate.
Molecular Properties
| Compound Name | 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate |
| PubChem CID | 141007289 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate |
| SMILES | C[N+]1(CC#N)CCNCC1.O=S(=O)([O-])Cc1ccccc1 |
| InChI | InChI=1S/C7H14N3.C7H8O3S/c1-10(5-2-8)6-3-9-4-7-10;8-11(9,10)6-7-4-2-1-3-5-7/h9H,3-7H2,1H3;1-5H,6H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | GRCXWVQPJKQUDH-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate?
The IUPAC name of 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate (CID 141007289) is 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate.
What is the SMILES notation for 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate?
The canonical SMILES for 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate is C[N+]1(CC#N)CCNCC1.O=S(=O)([O-])Cc1ccccc1.
What is the InChIKey of 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate?
The InChIKey is GRCXWVQPJKQUDH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14N3.C7H8O3S/c1-10(5-2-8)6-3-9-4-7-10;8-11(9,10)6-7-4-2-1-3-5-7/h9H,3-7H2,1H3;1-5H,6H2,(H,8,9,10)/q+1;/p-1.
What are the key properties of 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate?
2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate has a molecular weight of 311.41 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpiperazin-1-ium-1-yl)acetonitrile;phenylmethanesulfonate is sourced from PubChem (CID 141007289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).