About (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol
(2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol (PubChem CID 141007306) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol.
Analyze (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol?
The IUPAC name of (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol (CID 141007306) is (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol.
What is the SMILES notation for (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol?
The canonical SMILES for (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol is CC1OC2=C(O1)C(CO)C=C2.
What is the InChIKey of (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol?
The InChIKey is TYRPDVMODAGKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-5-10-7-3-2-6(4-9)8(7)11-5/h2-3,5-6,9H,4H2,1H3.
What are the key properties of (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol?
(2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol has a molecular weight of 154.16 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4H-cyclopenta[d][1,3]dioxol-4-yl)methanol is sourced from PubChem (CID 141007306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).