About 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione
3-prop-2-enoyl-1,3-oxazolidine-2,4-dione (PubChem CID 141007312) has the molecular formula C6H5NO4
and a molecular weight of 155.11 g/mol. Its IUPAC name is 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 141007312 |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione |
| SMILES | C=CC(=O)N1C(=O)COC1=O |
| InChI | InChI=1S/C6H5NO4/c1-2-4(8)7-5(9)3-11-6(7)10/h2H,1,3H2 |
| InChIKey | BPCGFICGMWQQLQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione (CID 141007312) is 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione is C=CC(=O)N1C(=O)COC1=O.
What is the InChIKey of 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione?
The InChIKey is BPCGFICGMWQQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4/c1-2-4(8)7-5(9)3-11-6(7)10/h2H,1,3H2.
What are the key properties of 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione?
3-prop-2-enoyl-1,3-oxazolidine-2,4-dione has a molecular weight of 155.11 g/mol, XLogP of -0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 141007312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).