C5H2ClF5 — CID 141007316
4-chloro-1,2,3,3,4-pentafluorocyclopentene (PubChem CID 141007316) has the molecular formula C5H2ClF5 and a molecular weight of 192.51 g/mol. Its IUPAC name is 4-chloro-1,2,3,3,4-pentafluorocyclopentene.
| Compound Name | 4-chloro-1,2,3,3,4-pentafluorocyclopentene |
|---|---|
| PubChem CID | 141007316 |
| Molecular Formula | C5H2ClF5 |
| Molecular Weight | 192.51 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 4-chloro-1,2,3,3,4-pentafluorocyclopentene |
| SMILES | FC1=C(F)C(F)(F)C(F)(Cl)C1 |
| InChI | InChI=1S/C5H2ClF5/c6-4(9)1-2(7)3(8)5(4,10)11/h1H2 |
| InChIKey | KKUWGOSSYCGWTC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|