C17H36N2O2 — CID 141007745
1-[4-(4-aminobutyl)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol (PubChem CID 141007745) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 1-[4-(4-aminobutyl)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol.
| Compound Name | 1-[4-(4-aminobutyl)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 141007745 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 1-[4-(4-aminobutyl)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CON1C(C)(C)CC(CCCCN)CC1(C)C |
| InChI | InChI=1S/C17H36N2O2/c1-15(2)11-14(9-7-8-10-18)12-16(3,4)19(15)21-13-17(5,6)20/h14,20H,7-13,18H2,1-6H3 |
| InChIKey | RGOBDBCLKGHBJK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|