About N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide
N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide (PubChem CID 141007797) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide |
| PubChem CID | 141007797 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide |
| SMILES | COCCCNC(=O)C1COCCO1 |
| InChI | InChI=1S/C9H17NO4/c1-12-4-2-3-10-9(11)8-7-13-5-6-14-8/h8H,2-7H2,1H3,(H,10,11) |
| InChIKey | DKBIWJFCSQGTLS-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide?
The IUPAC name of N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide (CID 141007797) is N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide is COCCCNC(=O)C1COCCO1.
What is the InChIKey of N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide?
The InChIKey is DKBIWJFCSQGTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-12-4-2-3-10-9(11)8-7-13-5-6-14-8/h8H,2-7H2,1H3,(H,10,11).
What are the key properties of N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide?
N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide has a molecular weight of 203.24 g/mol, XLogP of -0.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 141007797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).