About 5-methyl-N-propyl-1,3-dioxane-5-carboxamide
5-methyl-N-propyl-1,3-dioxane-5-carboxamide (PubChem CID 141007814) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-methyl-N-propyl-1,3-dioxane-5-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-propyl-1,3-dioxane-5-carboxamide |
| PubChem CID | 141007814 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 5-methyl-N-propyl-1,3-dioxane-5-carboxamide |
| SMILES | CCCNC(=O)C1(C)COCOC1 |
| InChI | InChI=1S/C9H17NO3/c1-3-4-10-8(11)9(2)5-12-7-13-6-9/h3-7H2,1-2H3,(H,10,11) |
| InChIKey | VHAPCRARTSYLKV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-N-propyl-1,3-dioxane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-propyl-1,3-dioxane-5-carboxamide?
The IUPAC name of 5-methyl-N-propyl-1,3-dioxane-5-carboxamide (CID 141007814) is 5-methyl-N-propyl-1,3-dioxane-5-carboxamide.
What is the SMILES notation for 5-methyl-N-propyl-1,3-dioxane-5-carboxamide?
The canonical SMILES for 5-methyl-N-propyl-1,3-dioxane-5-carboxamide is CCCNC(=O)C1(C)COCOC1.
What is the InChIKey of 5-methyl-N-propyl-1,3-dioxane-5-carboxamide?
The InChIKey is VHAPCRARTSYLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-4-10-8(11)9(2)5-12-7-13-6-9/h3-7H2,1-2H3,(H,10,11).
What are the key properties of 5-methyl-N-propyl-1,3-dioxane-5-carboxamide?
5-methyl-N-propyl-1,3-dioxane-5-carboxamide has a molecular weight of 187.24 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-propyl-1,3-dioxane-5-carboxamide is sourced from PubChem (CID 141007814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).