C17H13ClF3NO3 — CID 141007949
5-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoylamino]benzoic acid (PubChem CID 141007949) has the molecular formula C17H13ClF3NO3 and a molecular weight of 371.74 g/mol. Its IUPAC name is 5-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoylamino]benzoic acid.
| Compound Name | 5-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 141007949 |
| Molecular Formula | C17H13ClF3NO3 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 5-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoylamino]benzoic acid |
| SMILES | O=C(CCc1ccc(C(F)(F)F)cc1)Nc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C17H13ClF3NO3/c18-12-6-7-14(13(9-12)16(24)25)22-15(23)8-3-10-1-4-11(5-2-10)17(19,20)21/h1-2,4-7,9H,3,8H2,(H,22,23)(H,24,25) |
| InChIKey | NWQMYHKLEJTLJL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |