About methyl 2H-1,3-thiazole-3-carboxylate
methyl 2H-1,3-thiazole-3-carboxylate (PubChem CID 141008100) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is methyl 2H-1,3-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2H-1,3-thiazole-3-carboxylate |
| PubChem CID | 141008100 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | methyl 2H-1,3-thiazole-3-carboxylate |
| SMILES | COC(=O)N1C=CSC1 |
| InChI | InChI=1S/C5H7NO2S/c1-8-5(7)6-2-3-9-4-6/h2-3H,4H2,1H3 |
| InChIKey | DWQVTXSXUXDBSV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2H-1,3-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2H-1,3-thiazole-3-carboxylate?
The IUPAC name of methyl 2H-1,3-thiazole-3-carboxylate (CID 141008100) is methyl 2H-1,3-thiazole-3-carboxylate.
What is the SMILES notation for methyl 2H-1,3-thiazole-3-carboxylate?
The canonical SMILES for methyl 2H-1,3-thiazole-3-carboxylate is COC(=O)N1C=CSC1.
What is the InChIKey of methyl 2H-1,3-thiazole-3-carboxylate?
The InChIKey is DWQVTXSXUXDBSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c1-8-5(7)6-2-3-9-4-6/h2-3H,4H2,1H3.
What are the key properties of methyl 2H-1,3-thiazole-3-carboxylate?
methyl 2H-1,3-thiazole-3-carboxylate has a molecular weight of 145.18 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2H-1,3-thiazole-3-carboxylate is sourced from PubChem (CID 141008100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).