About 2-propyl-1,2,4-triazolidine-3-thione
2-propyl-1,2,4-triazolidine-3-thione (PubChem CID 141008201) has the molecular formula C5H11N3S
and a molecular weight of 145.23 g/mol. Its IUPAC name is 2-propyl-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | 2-propyl-1,2,4-triazolidine-3-thione |
| PubChem CID | 141008201 |
| Molecular Formula | C5H11N3S |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-propyl-1,2,4-triazolidine-3-thione |
| SMILES | CCCN1NCNC1=S |
| InChI | InChI=1S/C5H11N3S/c1-2-3-8-5(9)6-4-7-8/h7H,2-4H2,1H3,(H,6,9) |
| InChIKey | KBFLHOYPGCUQPQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1,2,4-triazolidine-3-thione?
The IUPAC name of 2-propyl-1,2,4-triazolidine-3-thione (CID 141008201) is 2-propyl-1,2,4-triazolidine-3-thione.
What is the SMILES notation for 2-propyl-1,2,4-triazolidine-3-thione?
The canonical SMILES for 2-propyl-1,2,4-triazolidine-3-thione is CCCN1NCNC1=S.
What is the InChIKey of 2-propyl-1,2,4-triazolidine-3-thione?
The InChIKey is KBFLHOYPGCUQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3S/c1-2-3-8-5(9)6-4-7-8/h7H,2-4H2,1H3,(H,6,9).
What are the key properties of 2-propyl-1,2,4-triazolidine-3-thione?
2-propyl-1,2,4-triazolidine-3-thione has a molecular weight of 145.23 g/mol, XLogP of 0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 141008201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).