C13H25N — CID 141008654
2,2,3,6,6-pentamethyl-1-prop-1-enylpiperidine (PubChem CID 141008654) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2,2,3,6,6-pentamethyl-1-prop-1-enylpiperidine.
| Compound Name | 2,2,3,6,6-pentamethyl-1-prop-1-enylpiperidine |
|---|---|
| PubChem CID | 141008654 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2,2,3,6,6-pentamethyl-1-prop-1-enylpiperidine |
| SMILES | CC=CN1C(C)(C)CCC(C)C1(C)C |
| InChI | InChI=1S/C13H25N/c1-7-10-14-12(3,4)9-8-11(2)13(14,5)6/h7,10-11H,8-9H2,1-6H3 |
| InChIKey | DJAYUFPTLRIZJK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |