C28H26Br2FN2O5P — CID 141008661
bis(1-(3-bromophenyl)-2-(1-methylpyridin-1-ium-2-yl)ethanone);fluoro-dioxido-oxo-λ5-phosphane (PubChem CID 141008661) has the molecular formula C28H26Br2FN2O5P and a molecular weight of 680.31 g/mol. Its IUPAC name is bis(1-(3-bromophenyl)-2-(1-methylpyridin-1-ium-2-yl)ethanone);fluoro-dioxido-oxo-λ5-phosphane.
| Compound Name | bis(1-(3-bromophenyl)-2-(1-methylpyridin-1-ium-2-yl)ethanone);fluoro-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 141008661 |
| Molecular Formula | C28H26Br2FN2O5P |
| Molecular Weight | 680.31 g/mol |
| Exact Mass | 677.99 |
| IUPAC Name | bis(1-(3-bromophenyl)-2-(1-methylpyridin-1-ium-2-yl)ethanone);fluoro-dioxido-oxo-λ5-phosphane |
| SMILES | C[n+]1ccccc1CC(=O)c1cccc(Br)c1.C[n+]1ccccc1CC(=O)c1cccc(Br)c1.O=P([O-])([O-])F |
| InChI | InChI=1S/2C14H13BrNO.FH2O3P/c2*1-16-8-3-2-7-13(16)10-14(17)11-5-4-6-12(15)9-11;1-5(2,3)4/h2*2-9H,10H2,1H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | QMOHHSLJSKJWFY-UHFFFAOYSA-L |
| XLogP | 4.18 |
| TPSA | 105.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|