About 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol
1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol (PubChem CID 141008765) has the molecular formula C18H31N3O3
and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol.
Molecular Properties
| Compound Name | 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol |
| PubChem CID | 141008765 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol |
| SMILES | CCC(O)CCC(O)CCC(O)c1cncc(N2CCNCC2)c1 |
| InChI | InChI=1S/C18H31N3O3/c1-2-16(22)3-4-17(23)5-6-18(24)14-11-15(13-20-12-14)21-9-7-19-8-10-21/h11-13,16-19,22-24H,2-10H2,1H3 |
| InChIKey | ZSBFWCOUKLDEAL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol?
The IUPAC name of 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol (CID 141008765) is 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol.
What is the SMILES notation for 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol?
The canonical SMILES for 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol is CCC(O)CCC(O)CCC(O)c1cncc(N2CCNCC2)c1.
What is the InChIKey of 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol?
The InChIKey is ZSBFWCOUKLDEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O3/c1-2-16(22)3-4-17(23)5-6-18(24)14-11-15(13-20-12-14)21-9-7-19-8-10-21/h11-13,16-19,22-24H,2-10H2,1H3.
What are the key properties of 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol?
1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol has a molecular weight of 337.46 g/mol, XLogP of 1.22, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-piperazin-1-yl-3-pyridinyl)nonane-1,4,7-triol is sourced from PubChem (CID 141008765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).