7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid

C7H6O4 — CID 141009870

IUPAC7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid
SMILESO=C(OO)C12C=CC=CC1O2
InChIInChI=1S/C7H6O4/c8-6(11-9)7-4-2-1-3-5(7)10-7/h1-5,9H
InChIKeyCUEBVSAYBPAHJH-UHFFFAOYSA-N
MW154.12 g/mol
LogP0.27
Rot. Bonds1

About 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid

7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid (PubChem CID 141009870) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid.

Molecular Properties

Compound Name7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid
PubChem CID141009870
Molecular FormulaC7H6O4
Molecular Weight154.12 g/mol
Exact Mass154.03
IUPAC Name7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid
SMILESO=C(OO)C12C=CC=CC1O2
InChIInChI=1S/C7H6O4/c8-6(11-9)7-4-2-1-3-5(7)10-7/h1-5,9H
InChIKeyCUEBVSAYBPAHJH-UHFFFAOYSA-N
XLogP0.27
TPSA59.06 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.12
LogP ≤ 50.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
The IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid (CID 141009870) is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid.
What is the SMILES notation for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
The canonical SMILES for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid is O=C(OO)C12C=CC=CC1O2.
What is the InChIKey of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
The InChIKey is CUEBVSAYBPAHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-6(11-9)7-4-2-1-3-5(7)10-7/h1-5,9H.
What are the key properties of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid has a molecular weight of 154.12 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid is sourced from PubChem (CID 141009870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).