About 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid
7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid (PubChem CID 141009870) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid |
| PubChem CID | 141009870 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid |
| SMILES | O=C(OO)C12C=CC=CC1O2 |
| InChI | InChI=1S/C7H6O4/c8-6(11-9)7-4-2-1-3-5(7)10-7/h1-5,9H |
| InChIKey | CUEBVSAYBPAHJH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
The IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid (CID 141009870) is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid.
What is the SMILES notation for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
The canonical SMILES for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid is O=C(OO)C12C=CC=CC1O2.
What is the InChIKey of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
The InChIKey is CUEBVSAYBPAHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-6(11-9)7-4-2-1-3-5(7)10-7/h1-5,9H.
What are the key properties of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid?
7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid has a molecular weight of 154.12 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboperoxoic acid is sourced from PubChem (CID 141009870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).