About 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine
6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 141011061) has the molecular formula C17H15N3S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 141011061 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | c1cc(-c2c[nH]c(-c3ccc4c(c3)NCCS4)c2)ccn1 |
| InChI | InChI=1S/C17H15N3S/c1-2-17-16(19-7-8-21-17)9-13(1)15-10-14(11-20-15)12-3-5-18-6-4-12/h1-6,9-11,19-20H,7-8H2 |
| InChIKey | FKBUARDHYGEVSL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine (CID 141011061) is 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine is c1cc(-c2c[nH]c(-c3ccc4c(c3)NCCS4)c2)ccn1.
What is the InChIKey of 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is FKBUARDHYGEVSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3S/c1-2-17-16(19-7-8-21-17)9-13(1)15-10-14(11-20-15)12-3-5-18-6-4-12/h1-6,9-11,19-20H,7-8H2.
What are the key properties of 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine?
6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 293.39 g/mol, XLogP of 4.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-pyridin-4-yl-1H-pyrrol-2-yl)-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 141011061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).