About (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin
(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin (PubChem CID 141011217) has the molecular formula C20H37NOSn
and a molecular weight of 426.23 g/mol. Its IUPAC name is (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin.
Molecular Properties
| Compound Name | (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin |
| PubChem CID | 141011217 |
| Molecular Formula | C20H37NOSn |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]C1=CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H27.C7H10NO.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-7(9)8-5-3-2-4-6-8;/h4-12H2,1-3H3;3H,4-6H2,1H3; |
| InChIKey | ZLVITKOOODJINU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin?
The IUPAC name of (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin (CID 141011217) is (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin.
What is the SMILES notation for (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin?
The canonical SMILES for (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin is CCCCC(CCCC)(CCCC)[Sn]C1=CCN(C(C)=O)CC1.
What is the InChIKey of (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin?
The InChIKey is ZLVITKOOODJINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C7H10NO.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-7(9)8-5-3-2-4-6-8;/h4-12H2,1-3H3;3H,4-6H2,1H3;.
What are the key properties of (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin?
(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin has a molecular weight of 426.23 g/mol, XLogP of 5.56, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-(5-butylnonan-5-yl)tin is sourced from PubChem (CID 141011217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).