C11H17N3O3S — CID 141011447
[(2R)-1-(2,2-dimethylhydrazinyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-methylcarbamic acid (PubChem CID 141011447) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is [(2R)-1-(2,2-dimethylhydrazinyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-methylcarbamic acid.
| Compound Name | [(2R)-1-(2,2-dimethylhydrazinyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 141011447 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [(2R)-1-(2,2-dimethylhydrazinyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-methylcarbamic acid |
| SMILES | CN(C)NC(=O)[C@@H](Cc1cccs1)N(C)C(=O)O |
| InChI | InChI=1S/C11H17N3O3S/c1-13(2)12-10(15)9(14(3)11(16)17)7-8-5-4-6-18-8/h4-6,9H,7H2,1-3H3,(H,12,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | ZASZZAHVTFRCQQ-SECBINFHSA-N |
| XLogP | 0.86 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|