About N-(2-fluorophenyl)-1,3-oxazol-2-amine
N-(2-fluorophenyl)-1,3-oxazol-2-amine (PubChem CID 141013030) has the molecular formula C9H7FN2O
and a molecular weight of 178.17 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-1,3-oxazol-2-amine |
| PubChem CID | 141013030 |
| Molecular Formula | C9H7FN2O |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | N-(2-fluorophenyl)-1,3-oxazol-2-amine |
| SMILES | Fc1ccccc1Nc1ncco1 |
| InChI | InChI=1S/C9H7FN2O/c10-7-3-1-2-4-8(7)12-9-11-5-6-13-9/h1-6H,(H,11,12) |
| InChIKey | RUUIMOHRHVSIRQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-fluorophenyl)-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-1,3-oxazol-2-amine?
The IUPAC name of N-(2-fluorophenyl)-1,3-oxazol-2-amine (CID 141013030) is N-(2-fluorophenyl)-1,3-oxazol-2-amine.
What is the SMILES notation for N-(2-fluorophenyl)-1,3-oxazol-2-amine?
The canonical SMILES for N-(2-fluorophenyl)-1,3-oxazol-2-amine is Fc1ccccc1Nc1ncco1.
What is the InChIKey of N-(2-fluorophenyl)-1,3-oxazol-2-amine?
The InChIKey is RUUIMOHRHVSIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O/c10-7-3-1-2-4-8(7)12-9-11-5-6-13-9/h1-6H,(H,11,12).
What are the key properties of N-(2-fluorophenyl)-1,3-oxazol-2-amine?
N-(2-fluorophenyl)-1,3-oxazol-2-amine has a molecular weight of 178.17 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-1,3-oxazol-2-amine is sourced from PubChem (CID 141013030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).