C13H25N3 — CID 141013524
N-butyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine (PubChem CID 141013524) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-butyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine.
| Compound Name | N-butyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine |
|---|---|
| PubChem CID | 141013524 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-butyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine |
| SMILES | CCCCNC1CCCCC2=NCCCN21 |
| InChI | InChI=1S/C13H25N3/c1-2-3-9-14-12-7-4-5-8-13-15-10-6-11-16(12)13/h12,14H,2-11H2,1H3 |
| InChIKey | OPJNBXJUONRLSB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|