About 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid
2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid (PubChem CID 141014129) has the molecular formula C18H11N3O5
and a molecular weight of 349.30 g/mol. Its IUPAC name is 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid |
| PubChem CID | 141014129 |
| Molecular Formula | C18H11N3O5 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2cc(-c3ccccc3)no2)ccc1Nn1c(=O)c1=O |
| InChI | InChI=1S/C18H11N3O5/c22-16-17(23)21(16)19-13-7-6-11(8-12(13)18(24)25)15-9-14(20-26-15)10-4-2-1-3-5-10/h1-9,19H,(H,24,25) |
| InChIKey | FUBKSHAOJKIQGD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid?
The IUPAC name of 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid (CID 141014129) is 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid.
What is the SMILES notation for 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid?
The canonical SMILES for 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid is O=C(O)c1cc(-c2cc(-c3ccccc3)no2)ccc1Nn1c(=O)c1=O.
What is the InChIKey of 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid?
The InChIKey is FUBKSHAOJKIQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O5/c22-16-17(23)21(16)19-13-7-6-11(8-12(13)18(24)25)15-9-14(20-26-15)10-4-2-1-3-5-10/h1-9,19H,(H,24,25).
What are the key properties of 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid?
2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid has a molecular weight of 349.30 g/mol, XLogP of 1.98, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dioxoaziridin-1-yl)amino]-5-(3-phenyl-1,2-oxazol-5-yl)benzoic acid is sourced from PubChem (CID 141014129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).