C21H20N2O6 — CID 141014161
6-[(2-ethoxy-2-oxoacetyl)amino]-1-[(3-methoxyphenyl)methyl]indole-5-carboxylic acid (PubChem CID 141014161) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 6-[(2-ethoxy-2-oxoacetyl)amino]-1-[(3-methoxyphenyl)methyl]indole-5-carboxylic acid.
| Compound Name | 6-[(2-ethoxy-2-oxoacetyl)amino]-1-[(3-methoxyphenyl)methyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 141014161 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 6-[(2-ethoxy-2-oxoacetyl)amino]-1-[(3-methoxyphenyl)methyl]indole-5-carboxylic acid |
| SMILES | CCOC(=O)C(=O)Nc1cc2c(ccn2Cc2cccc(OC)c2)cc1C(=O)O |
| InChI | InChI=1S/C21H20N2O6/c1-3-29-21(27)19(24)22-17-11-18-14(10-16(17)20(25)26)7-8-23(18)12-13-5-4-6-15(9-13)28-2/h4-11H,3,12H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | KSSZGAIGMXPQHH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|